C19H41NO5Si — CID 175411747
triethoxy-[1-(1-methoxy-2,2,3,3-tetramethylpiperidin-4-yl)oxypropyl]silane (PubChem CID 175411747) has the molecular formula C19H41NO5Si and a molecular weight of 391.63 g/mol. Its IUPAC name is triethoxy-[1-(1-methoxy-2,2,3,3-tetramethylpiperidin-4-yl)oxypropyl]silane.
| Compound Name | triethoxy-[1-(1-methoxy-2,2,3,3-tetramethylpiperidin-4-yl)oxypropyl]silane |
|---|---|
| PubChem CID | 175411747 |
| Molecular Formula | C19H41NO5Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | triethoxy-[1-(1-methoxy-2,2,3,3-tetramethylpiperidin-4-yl)oxypropyl]silane |
| SMILES | CCO[Si](OCC)(OCC)C(CC)OC1CCN(OC)C(C)(C)C1(C)C |
| InChI | InChI=1S/C19H41NO5Si/c1-10-17(26(22-11-2,23-12-3)24-13-4)25-16-14-15-20(21-9)19(7,8)18(16,5)6/h16-17H,10-15H2,1-9H3 |
| InChIKey | UXNLJPRDCBCTMF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|