C29H41NO2 — CID 175413879
(4E,7Z)-docosa-4,7,10,13,16,19-hexaenoic acid;phenylmethanamine (PubChem CID 175413879) has the molecular formula C29H41NO2 and a molecular weight of 435.65 g/mol. Its IUPAC name is (4E,7Z)-docosa-4,7,10,13,16,19-hexaenoic acid;phenylmethanamine.
| Compound Name | (4E,7Z)-docosa-4,7,10,13,16,19-hexaenoic acid;phenylmethanamine |
|---|---|
| PubChem CID | 175413879 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | (4E,7Z)-docosa-4,7,10,13,16,19-hexaenoic acid;phenylmethanamine |
| SMILES | CCC=CCC=CCC=CCC=CC/C=C\C/C=C/CCC(=O)O.NCc1ccccc1 |
| InChI | InChI=1S/C22H32O2.C7H9N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;8-6-7-4-2-1-3-5-7/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24);1-5H,6,8H2/b4-3?,7-6?,10-9?,13-12?,16-15-,19-18+; |
| InChIKey | ASZRONJWPXCHPO-JVNNGWMRSA-N |
| XLogP | 7.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|