C14H24O6S — CID 175414192
2,3,4,5,6-pentahydroxyhexanal;2-propan-2-yl-2H-thiopyran (PubChem CID 175414192) has the molecular formula C14H24O6S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;2-propan-2-yl-2H-thiopyran.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;2-propan-2-yl-2H-thiopyran |
|---|---|
| PubChem CID | 175414192 |
| Molecular Formula | C14H24O6S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;2-propan-2-yl-2H-thiopyran |
| SMILES | CC(C)C1C=CC=CS1.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H12S.C6H12O6/c1-7(2)8-5-3-4-6-9-8;7-1-3(9)5(11)6(12)4(10)2-8/h3-8H,1-2H3;1,3-6,8-12H,2H2 |
| InChIKey | ILKCIQVMFRLVDJ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|