C5H14ClCuN3 — CID 175414333
copper;1,1,2,3-tetramethylguanidine;hydrochloride (PubChem CID 175414333) has the molecular formula C5H14ClCuN3 and a molecular weight of 215.19 g/mol. Its IUPAC name is copper;1,1,2,3-tetramethylguanidine;hydrochloride.
| Compound Name | copper;1,1,2,3-tetramethylguanidine;hydrochloride |
|---|---|
| PubChem CID | 175414333 |
| Molecular Formula | C5H14ClCuN3 |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | copper;1,1,2,3-tetramethylguanidine;hydrochloride |
| SMILES | C/N=C(/NC)N(C)C.Cl.[Cu] |
| InChI | InChI=1S/C5H13N3.ClH.Cu/c1-6-5(7-2)8(3)4;;/h1-4H3,(H,6,7);1H; |
| InChIKey | NCPQBDZBLXZJPQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|