About [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate
[2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate (PubChem CID 175414517) has the molecular formula C23H14N6O7S
and a molecular weight of 518.47 g/mol. Its IUPAC name is [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate |
| PubChem CID | 175414517 |
| Molecular Formula | C23H14N6O7S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate |
| SMILES | [N-]=[N+]=Nc1ccc2c(S(=O)(=O)Oc3c(C(=O)c4ccc(O)cc4)ccc(O)c3O)cccc2c1N=[N+]=[N-] |
| InChI | InChI=1S/C23H14N6O7S/c24-28-26-17-10-8-14-15(20(17)27-29-25)2-1-3-19(14)37(34,35)36-23-16(9-11-18(31)22(23)33)21(32)12-4-6-13(30)7-5-12/h1-11,30-31,33H |
| InChIKey | SXJNKPAHHYOHRU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 218.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate?
The IUPAC name of [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate (CID 175414517) is [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate.
What is the SMILES notation for [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate?
The canonical SMILES for [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate is [N-]=[N+]=Nc1ccc2c(S(=O)(=O)Oc3c(C(=O)c4ccc(O)cc4)ccc(O)c3O)cccc2c1N=[N+]=[N-].
What is the InChIKey of [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate?
The InChIKey is SXJNKPAHHYOHRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14N6O7S/c24-28-26-17-10-8-14-15(20(17)27-29-25)2-1-3-19(14)37(34,35)36-23-16(9-11-18(31)22(23)33)21(32)12-4-6-13(30)7-5-12/h1-11,30-31,33H.
What are the key properties of [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate?
[2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate has a molecular weight of 518.47 g/mol, XLogP of 5.84, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dihydroxy-6-(4-hydroxybenzoyl)phenyl] 5,6-diazidonaphthalene-1-sulfonate is sourced from PubChem (CID 175414517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).