About 3,5-dinitro-1H-pyrazol-4-ol;guanidine
3,5-dinitro-1H-pyrazol-4-ol;guanidine (PubChem CID 175414835) has the molecular formula C4H7N7O5
and a molecular weight of 233.14 g/mol. Its IUPAC name is 3,5-dinitro-1H-pyrazol-4-ol;guanidine.
Molecular Properties
| Compound Name | 3,5-dinitro-1H-pyrazol-4-ol;guanidine |
| PubChem CID | 175414835 |
| Molecular Formula | C4H7N7O5 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 3,5-dinitro-1H-pyrazol-4-ol;guanidine |
| SMILES | O=[N+]([O-])c1n[nH]c([N+](=O)[O-])c1O.[H]N=C(N)N |
| InChI | InChI=1S/C3H2N4O5.CH5N3/c8-1-2(6(9)10)4-5-3(1)7(11)12;2-1(3)4/h8H,(H,4,5);(H5,2,3,4) |
| InChIKey | XYDMQTRVQPBMOQ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 211.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dinitro-1H-pyrazol-4-ol;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dinitro-1H-pyrazol-4-ol;guanidine?
The IUPAC name of 3,5-dinitro-1H-pyrazol-4-ol;guanidine (CID 175414835) is 3,5-dinitro-1H-pyrazol-4-ol;guanidine.
What is the SMILES notation for 3,5-dinitro-1H-pyrazol-4-ol;guanidine?
The canonical SMILES for 3,5-dinitro-1H-pyrazol-4-ol;guanidine is O=[N+]([O-])c1n[nH]c([N+](=O)[O-])c1O.[H]N=C(N)N.
What is the InChIKey of 3,5-dinitro-1H-pyrazol-4-ol;guanidine?
The InChIKey is XYDMQTRVQPBMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N4O5.CH5N3/c8-1-2(6(9)10)4-5-3(1)7(11)12;2-1(3)4/h8H,(H,4,5);(H5,2,3,4).
What are the key properties of 3,5-dinitro-1H-pyrazol-4-ol;guanidine?
3,5-dinitro-1H-pyrazol-4-ol;guanidine has a molecular weight of 233.14 g/mol, XLogP of -1.23, 2 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitro-1H-pyrazol-4-ol;guanidine is sourced from PubChem (CID 175414835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).