About 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one
1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one (PubChem CID 175414926) has the molecular formula C27H23N5O3S
and a molecular weight of 497.58 g/mol. Its IUPAC name is 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one |
| PubChem CID | 175414926 |
| Molecular Formula | C27H23N5O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one |
| SMILES | NNC(=O)Nc1ccccc1.O=C(c1cccs1)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H14N2O2S.C7H9N3O/c23-19(16-12-7-13-25-16)17-18(14-8-3-1-4-9-14)21-22(20(17)24)15-10-5-2-6-11-15;8-10-7(11)9-6-4-2-1-3-5-6/h1-13,21H;1-5H,8H2,(H2,9,10,11) |
| InChIKey | UGIZHITUVBTNOB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one?
The IUPAC name of 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one (CID 175414926) is 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one.
What is the SMILES notation for 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one?
The canonical SMILES for 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one is NNC(=O)Nc1ccccc1.O=C(c1cccs1)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O.
What is the InChIKey of 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one?
The InChIKey is UGIZHITUVBTNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O2S.C7H9N3O/c23-19(16-12-7-13-25-16)17-18(14-8-3-1-4-9-14)21-22(20(17)24)15-10-5-2-6-11-15;8-10-7(11)9-6-4-2-1-3-5-6/h1-13,21H;1-5H,8H2,(H2,9,10,11).
What are the key properties of 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one?
1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one has a molecular weight of 497.58 g/mol, XLogP of 4.81, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-phenylurea;2,5-diphenyl-4-(thiophene-2-carbonyl)-1H-pyrazol-3-one is sourced from PubChem (CID 175414926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).