C10H12F8O4S2 — CID 175415040
2,2,4,5-tetrafluoro-4-methylthiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-methylthiolane 1,1-dioxide (PubChem CID 175415040) has the molecular formula C10H12F8O4S2 and a molecular weight of 412.32 g/mol. Its IUPAC name is 2,2,4,5-tetrafluoro-4-methylthiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-methylthiolane 1,1-dioxide.
| Compound Name | 2,2,4,5-tetrafluoro-4-methylthiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-methylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 175415040 |
| Molecular Formula | C10H12F8O4S2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 2,2,4,5-tetrafluoro-4-methylthiolane 1,1-dioxide;2,3,3,4-tetrafluoro-4-methylthiolane 1,1-dioxide |
| SMILES | CC1(F)CC(F)(F)S(=O)(=O)C1F.CC1(F)CS(=O)(=O)C(F)C1(F)F |
| InChI | InChI=1S/2C5H6F4O2S/c1-4(7)2-12(10,11)3(6)5(4,8)9;1-4(7)2-5(8,9)12(10,11)3(4)6/h2*3H,2H2,1H3 |
| InChIKey | DRXAYELUUZJCPX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |