About 4-(furan-2-yl)-2,6-dimethylmorpholine
4-(furan-2-yl)-2,6-dimethylmorpholine (PubChem CID 175415058) has the molecular formula C10H15NO2
and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-(furan-2-yl)-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(furan-2-yl)-2,6-dimethylmorpholine |
| PubChem CID | 175415058 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 4-(furan-2-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2ccco2)CC(C)O1 |
| InChI | InChI=1S/C10H15NO2/c1-8-6-11(7-9(2)13-8)10-4-3-5-12-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | MODMQHANDQEKTB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(furan-2-yl)-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)-2,6-dimethylmorpholine?
The IUPAC name of 4-(furan-2-yl)-2,6-dimethylmorpholine (CID 175415058) is 4-(furan-2-yl)-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(furan-2-yl)-2,6-dimethylmorpholine?
The canonical SMILES for 4-(furan-2-yl)-2,6-dimethylmorpholine is CC1CN(c2ccco2)CC(C)O1.
What is the InChIKey of 4-(furan-2-yl)-2,6-dimethylmorpholine?
The InChIKey is MODMQHANDQEKTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-8-6-11(7-9(2)13-8)10-4-3-5-12-10/h3-5,8-9H,6-7H2,1-2H3.
What are the key properties of 4-(furan-2-yl)-2,6-dimethylmorpholine?
4-(furan-2-yl)-2,6-dimethylmorpholine has a molecular weight of 181.24 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)-2,6-dimethylmorpholine is sourced from PubChem (CID 175415058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).