About N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide
N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide (PubChem CID 175415559) has the molecular formula C21H25F2N3O4
and a molecular weight of 421.44 g/mol. Its IUPAC name is N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide.
Molecular Properties
| Compound Name | N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide |
| PubChem CID | 175415559 |
| Molecular Formula | C21H25F2N3O4 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide |
| SMILES | COc1cc(N2CCC(Oc3ccc(F)cc3F)CC2)c(NC(=O)C(C)OC)cn1 |
| InChI | InChI=1S/C21H25F2N3O4/c1-13(28-2)21(27)25-17-12-24-20(29-3)11-18(17)26-8-6-15(7-9-26)30-19-5-4-14(22)10-16(19)23/h4-5,10-13,15H,6-9H2,1-3H3,(H,25,27) |
| InChIKey | LDHRFYQRYRBGKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide?
The IUPAC name of N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide (CID 175415559) is N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide.
What is the SMILES notation for N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide?
The canonical SMILES for N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide is COc1cc(N2CCC(Oc3ccc(F)cc3F)CC2)c(NC(=O)C(C)OC)cn1.
What is the InChIKey of N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide?
The InChIKey is LDHRFYQRYRBGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2N3O4/c1-13(28-2)21(27)25-17-12-24-20(29-3)11-18(17)26-8-6-15(7-9-26)30-19-5-4-14(22)10-16(19)23/h4-5,10-13,15H,6-9H2,1-3H3,(H,25,27).
What are the key properties of N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide?
N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide has a molecular weight of 421.44 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-methoxy-3-pyridinyl]-2-methoxypropanamide is sourced from PubChem (CID 175415559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).