About 1,2-di(propan-2-yl)naphthalene;1H-pyrrole
1,2-di(propan-2-yl)naphthalene;1H-pyrrole (PubChem CID 175415753) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)naphthalene;1H-pyrrole.
Molecular Properties
| Compound Name | 1,2-di(propan-2-yl)naphthalene;1H-pyrrole |
| PubChem CID | 175415753 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1,2-di(propan-2-yl)naphthalene;1H-pyrrole |
| SMILES | CC(C)c1ccc2ccccc2c1C(C)C.c1cc[nH]c1 |
| InChI | InChI=1S/C16H20.C4H5N/c1-11(2)14-10-9-13-7-5-6-8-15(13)16(14)12(3)4;1-2-4-5-3-1/h5-12H,1-4H3;1-5H |
| InChIKey | JHRIWTSWRAANSQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-di(propan-2-yl)naphthalene;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(propan-2-yl)naphthalene;1H-pyrrole?
The IUPAC name of 1,2-di(propan-2-yl)naphthalene;1H-pyrrole (CID 175415753) is 1,2-di(propan-2-yl)naphthalene;1H-pyrrole.
What is the SMILES notation for 1,2-di(propan-2-yl)naphthalene;1H-pyrrole?
The canonical SMILES for 1,2-di(propan-2-yl)naphthalene;1H-pyrrole is CC(C)c1ccc2ccccc2c1C(C)C.c1cc[nH]c1.
What is the InChIKey of 1,2-di(propan-2-yl)naphthalene;1H-pyrrole?
The InChIKey is JHRIWTSWRAANSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20.C4H5N/c1-11(2)14-10-9-13-7-5-6-8-15(13)16(14)12(3)4;1-2-4-5-3-1/h5-12H,1-4H3;1-5H.
What are the key properties of 1,2-di(propan-2-yl)naphthalene;1H-pyrrole?
1,2-di(propan-2-yl)naphthalene;1H-pyrrole has a molecular weight of 279.43 g/mol, XLogP of 6.10, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(propan-2-yl)naphthalene;1H-pyrrole is sourced from PubChem (CID 175415753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).