C18H23F3N2O3 — CID 175416978
4-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]butan-2-one (PubChem CID 175416978) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 4-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]butan-2-one.
| Compound Name | 4-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]butan-2-one |
|---|---|
| PubChem CID | 175416978 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-hydroxy-4-[1-[4-(trifluoromethoxy)phenyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]butan-2-one |
| SMILES | CC(=O)CC(O)N1CCCC2C1CCN2c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F3N2O3/c1-12(24)11-17(25)23-9-2-3-15-16(23)8-10-22(15)13-4-6-14(7-5-13)26-18(19,20)21/h4-7,15-17,25H,2-3,8-11H2,1H3 |
| InChIKey | NDBSNWMYZMVJIJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|