About N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine
N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine (PubChem CID 175417307) has the molecular formula C7H8F3N3O
and a molecular weight of 207.16 g/mol. Its IUPAC name is N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine.
Molecular Properties
| Compound Name | N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine |
| PubChem CID | 175417307 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine |
| SMILES | CNc1cnc(OC(F)C(F)F)cn1 |
| InChI | InChI=1S/C7H8F3N3O/c1-11-4-2-13-5(3-12-4)14-7(10)6(8)9/h2-3,6-7H,1H3,(H,11,12) |
| InChIKey | QNSRUYNZMCDDCJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine?
The IUPAC name of N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine (CID 175417307) is N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine.
What is the SMILES notation for N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine?
The canonical SMILES for N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine is CNc1cnc(OC(F)C(F)F)cn1.
What is the InChIKey of N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine?
The InChIKey is QNSRUYNZMCDDCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O/c1-11-4-2-13-5(3-12-4)14-7(10)6(8)9/h2-3,6-7H,1H3,(H,11,12).
What are the key properties of N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine?
N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine has a molecular weight of 207.16 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-(1,2,2-trifluoroethoxy)pyrazin-2-amine is sourced from PubChem (CID 175417307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).