About 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole
3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole (PubChem CID 175417400) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole.
Molecular Properties
| Compound Name | 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole |
| PubChem CID | 175417400 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole |
| SMILES | CC1(C2CCCCC2)C=C(C2CCCCC2)NN1 |
| InChI | InChI=1S/C16H28N2/c1-16(14-10-6-3-7-11-14)12-15(17-18-16)13-8-4-2-5-9-13/h12-14,17-18H,2-11H2,1H3 |
| InChIKey | AIZOVBQNXFZDMG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole?
The IUPAC name of 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole (CID 175417400) is 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole.
What is the SMILES notation for 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole?
The canonical SMILES for 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole is CC1(C2CCCCC2)C=C(C2CCCCC2)NN1.
What is the InChIKey of 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole?
The InChIKey is AIZOVBQNXFZDMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c1-16(14-10-6-3-7-11-14)12-15(17-18-16)13-8-4-2-5-9-13/h12-14,17-18H,2-11H2,1H3.
What are the key properties of 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole?
3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole has a molecular weight of 248.41 g/mol, XLogP of 3.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dicyclohexyl-3-methyl-1,2-dihydropyrazole is sourced from PubChem (CID 175417400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).