About [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid
[5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid (PubChem CID 175417520) has the molecular formula C11H13BFN3O3
and a molecular weight of 265.05 g/mol. Its IUPAC name is [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid.
Molecular Properties
| Compound Name | [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid |
| PubChem CID | 175417520 |
| Molecular Formula | C11H13BFN3O3 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid |
| SMILES | Cc1cc2c(cc1F)c(B(O)O)nn2C1NCCO1 |
| InChI | InChI=1S/C11H13BFN3O3/c1-6-4-9-7(5-8(6)13)10(12(17)18)15-16(9)11-14-2-3-19-11/h4-5,11,14,17-18H,2-3H2,1H3 |
| InChIKey | IRXSJJSRZNJEAZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid?
The IUPAC name of [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid (CID 175417520) is [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid.
What is the SMILES notation for [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid?
The canonical SMILES for [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid is Cc1cc2c(cc1F)c(B(O)O)nn2C1NCCO1.
What is the InChIKey of [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid?
The InChIKey is IRXSJJSRZNJEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BFN3O3/c1-6-4-9-7(5-8(6)13)10(12(17)18)15-16(9)11-14-2-3-19-11/h4-5,11,14,17-18H,2-3H2,1H3.
What are the key properties of [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid?
[5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid has a molecular weight of 265.05 g/mol, XLogP of -0.76, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-6-methyl-1-(1,3-oxazolidin-2-yl)indazol-3-yl]boronic acid is sourced from PubChem (CID 175417520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).