About 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol
2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol (PubChem CID 175418341) has the molecular formula C24H21O4P
and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol.
Molecular Properties
| Compound Name | 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol |
| PubChem CID | 175418341 |
| Molecular Formula | C24H21O4P |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol |
| SMILES | Cc1cccc(C)c1OP(=O)(c1ccccc1)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C24H21O4P/c1-16-9-8-10-17(2)24(16)28-29(27,18-11-4-3-5-12-18)22-15-21(25)19-13-6-7-14-20(19)23(22)26/h3-15,25-26H,1-2H3 |
| InChIKey | XQZPBEREDJSUSC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol?
The IUPAC name of 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol (CID 175418341) is 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol.
What is the SMILES notation for 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol?
The canonical SMILES for 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol is Cc1cccc(C)c1OP(=O)(c1ccccc1)c1cc(O)c2ccccc2c1O.
What is the InChIKey of 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol?
The InChIKey is XQZPBEREDJSUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21O4P/c1-16-9-8-10-17(2)24(16)28-29(27,18-11-4-3-5-12-18)22-15-21(25)19-13-6-7-14-20(19)23(22)26/h3-15,25-26H,1-2H3.
What are the key properties of 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol?
2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol has a molecular weight of 404.40 g/mol, XLogP of 5.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dimethylphenoxy)-phenylphosphoryl]naphthalene-1,4-diol is sourced from PubChem (CID 175418341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).