C23H21FN2O2 — CID 175418472
4-[1-[4-[2-(5-fluorobenzimidazol-1-yl)ethyl]phenoxy]ethyl]phenol (PubChem CID 175418472) has the molecular formula C23H21FN2O2 and a molecular weight of 376.43 g/mol. Its IUPAC name is 4-[1-[4-[2-(5-fluorobenzimidazol-1-yl)ethyl]phenoxy]ethyl]phenol.
| Compound Name | 4-[1-[4-[2-(5-fluorobenzimidazol-1-yl)ethyl]phenoxy]ethyl]phenol |
|---|---|
| PubChem CID | 175418472 |
| Molecular Formula | C23H21FN2O2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[1-[4-[2-(5-fluorobenzimidazol-1-yl)ethyl]phenoxy]ethyl]phenol |
| SMILES | CC(Oc1ccc(CCn2cnc3cc(F)ccc32)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H21FN2O2/c1-16(18-4-7-20(27)8-5-18)28-21-9-2-17(3-10-21)12-13-26-15-25-22-14-19(24)6-11-23(22)26/h2-11,14-16,27H,12-13H2,1H3 |
| InChIKey | RGWUADYXQLAVJN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |