About 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one
2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one (PubChem CID 175418760) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one |
| PubChem CID | 175418760 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one |
| SMILES | CCCCN1C(=O)C2=C(CCC=C2)C1(O)CCCC |
| InChI | InChI=1S/C16H25NO2/c1-3-5-11-16(19)14-10-8-7-9-13(14)15(18)17(16)12-6-4-2/h7,9,19H,3-6,8,10-12H2,1-2H3 |
| InChIKey | CGBZEUQBECAWGY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one?
The IUPAC name of 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one (CID 175418760) is 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one.
What is the SMILES notation for 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one?
The canonical SMILES for 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one is CCCCN1C(=O)C2=C(CCC=C2)C1(O)CCCC.
What is the InChIKey of 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one?
The InChIKey is CGBZEUQBECAWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-3-5-11-16(19)14-10-8-7-9-13(14)15(18)17(16)12-6-4-2/h7,9,19H,3-6,8,10-12H2,1-2H3.
What are the key properties of 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one?
2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one has a molecular weight of 263.38 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibutyl-3-hydroxy-4,5-dihydroisoindol-1-one is sourced from PubChem (CID 175418760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).