About azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline
azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline (PubChem CID 175418781) has the molecular formula C17H17BrN2
and a molecular weight of 329.24 g/mol. Its IUPAC name is azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline.
Molecular Properties
| Compound Name | azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline |
| PubChem CID | 175418781 |
| Molecular Formula | C17H17BrN2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline |
| SMILES | Cc1nc(-c2ccc(Br)cc2)c(C)c2ccccc12.N |
| InChI | InChI=1S/C17H14BrN.H3N/c1-11-15-5-3-4-6-16(15)12(2)19-17(11)13-7-9-14(18)10-8-13;/h3-10H,1-2H3;1H3 |
| InChIKey | CCGCSDNKFLSJDC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline?
The IUPAC name of azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline (CID 175418781) is azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline.
What is the SMILES notation for azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline?
The canonical SMILES for azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline is Cc1nc(-c2ccc(Br)cc2)c(C)c2ccccc12.N.
What is the InChIKey of azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline?
The InChIKey is CCGCSDNKFLSJDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN.H3N/c1-11-15-5-3-4-6-16(15)12(2)19-17(11)13-7-9-14(18)10-8-13;/h3-10H,1-2H3;1H3.
What are the key properties of azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline?
azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline has a molecular weight of 329.24 g/mol, XLogP of 5.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-(4-bromophenyl)-1,4-dimethylisoquinoline is sourced from PubChem (CID 175418781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).