C29H44Si — CID 175418999
2-[1,2,3,4,5,6-hexakis(prop-2-enyl)cyclohexa-2,4-dien-1-yl]ethyl-trimethylsilane (PubChem CID 175418999) has the molecular formula C29H44Si and a molecular weight of 420.76 g/mol. Its IUPAC name is 2-[1,2,3,4,5,6-hexakis(prop-2-enyl)cyclohexa-2,4-dien-1-yl]ethyl-trimethylsilane.
| Compound Name | 2-[1,2,3,4,5,6-hexakis(prop-2-enyl)cyclohexa-2,4-dien-1-yl]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175418999 |
| Molecular Formula | C29H44Si |
| Molecular Weight | 420.76 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | 2-[1,2,3,4,5,6-hexakis(prop-2-enyl)cyclohexa-2,4-dien-1-yl]ethyl-trimethylsilane |
| SMILES | C=CCC1=C(CC=C)C(CC=C)C(CC=C)(CC[Si](C)(C)C)C(CC=C)=C1CC=C |
| InChI | InChI=1S/C29H44Si/c1-10-16-24-25(17-11-2)27(19-13-4)29(21-15-6,22-23-30(7,8)9)28(20-14-5)26(24)18-12-3/h10-15,27H,1-6,16-23H2,7-9H3 |
| InChIKey | OICNPLLMJVKDHS-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.76 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|