C17H21F3O4 — CID 175419222
2,2-di(cyclopenten-1-yloxy)ethyl 4,4,4-trifluoro-2-methylbut-2-enoate (PubChem CID 175419222) has the molecular formula C17H21F3O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is 2,2-di(cyclopenten-1-yloxy)ethyl 4,4,4-trifluoro-2-methylbut-2-enoate.
| Compound Name | 2,2-di(cyclopenten-1-yloxy)ethyl 4,4,4-trifluoro-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 175419222 |
| Molecular Formula | C17H21F3O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2,2-di(cyclopenten-1-yloxy)ethyl 4,4,4-trifluoro-2-methylbut-2-enoate |
| SMILES | CC(=CC(F)(F)F)C(=O)OCC(OC1=CCCC1)OC1=CCCC1 |
| InChI | InChI=1S/C17H21F3O4/c1-12(10-17(18,19)20)16(21)22-11-15(23-13-6-2-3-7-13)24-14-8-4-5-9-14/h6,8,10,15H,2-5,7,9,11H2,1H3 |
| InChIKey | VJUSESYPMXIZBW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|