C26H35N5O6 — CID 175419967
1-amino-17-[(E)-1-[4-(azidomethyl)phenyl]ethylideneamino]oxyheptadecane-3,6,9,12,15-pentone (PubChem CID 175419967) has the molecular formula C26H35N5O6 and a molecular weight of 513.60 g/mol. Its IUPAC name is 1-amino-17-[(E)-1-[4-(azidomethyl)phenyl]ethylideneamino]oxyheptadecane-3,6,9,12,15-pentone.
| Compound Name | 1-amino-17-[(E)-1-[4-(azidomethyl)phenyl]ethylideneamino]oxyheptadecane-3,6,9,12,15-pentone |
|---|---|
| PubChem CID | 175419967 |
| Molecular Formula | C26H35N5O6 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 1-amino-17-[(E)-1-[4-(azidomethyl)phenyl]ethylideneamino]oxyheptadecane-3,6,9,12,15-pentone |
| SMILES | C/C(=N\OCCC(=O)CCC(=O)CCC(=O)CCC(=O)CCC(=O)CCN)c1ccc(CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C26H35N5O6/c1-19(21-4-2-20(3-5-21)18-29-31-28)30-37-17-15-26(36)13-11-24(34)9-7-22(32)6-8-23(33)10-12-25(35)14-16-27/h2-5H,6-18,27H2,1H3/b30-19+ |
| InChIKey | DYFDZADWOCGFIX-NDZAJKAJSA-N |
| XLogP | 3.94 |
| TPSA | 181.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|