C29H22F9NO — CID 175420127
1-benzyl-3-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-4,5-diphenylpyrrol-2-one (PubChem CID 175420127) has the molecular formula C29H22F9NO and a molecular weight of 571.48 g/mol. Its IUPAC name is 1-benzyl-3-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-4,5-diphenylpyrrol-2-one.
| Compound Name | 1-benzyl-3-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-4,5-diphenylpyrrol-2-one |
|---|---|
| PubChem CID | 175420127 |
| Molecular Formula | C29H22F9NO |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 1-benzyl-3-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)-4,5-diphenylpyrrol-2-one |
| SMILES | CC1(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)N(Cc2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C29H22F9NO/c1-25(18-26(30,31)27(32,33)28(34,35)29(36,37)38)22(20-13-7-3-8-14-20)23(21-15-9-4-10-16-21)39(24(25)40)17-19-11-5-2-6-12-19/h2-16H,17-18H2,1H3 |
| InChIKey | ZJPGWWHQQJIQJF-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|