C12H22O12 — CID 175420137
(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4,5-tetrol (PubChem CID 175420137) has the molecular formula C12H22O12 and a molecular weight of 358.30 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 175420137 |
| Molecular Formula | C12H22O12 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@H](O[C@@]2(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O12/c13-1-3-5(15)7(17)9(19)11(22-3)24-12(21)10(20)8(18)6(16)4(2-14)23-12/h3-11,13-21H,1-2H2/t3-,4-,5+,6+,7+,8+,9+,10-,11+,12+/m1/s1 |
| InChIKey | MSTHZTIDXJFNJI-NJEDTHRPSA-N |
| XLogP | -6.08 |
| TPSA | 209.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|