About 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene
1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene (PubChem CID 175420156) has the molecular formula C20H18O5S
and a molecular weight of 370.43 g/mol. Its IUPAC name is 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene.
Molecular Properties
| Compound Name | 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene |
| PubChem CID | 175420156 |
| Molecular Formula | C20H18O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene |
| SMILES | O=S(=O)(O)C1(O)c2ccccc2C=CC1O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H10O5S.C10H8/c11-9-6-5-7-3-1-2-4-8(7)10(9,12)16(13,14)15;1-2-6-10-8-4-3-7-9(10)5-1/h1-6,9,11-12H,(H,13,14,15);1-8H |
| InChIKey | YCIGIZMSBZHCDG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene?
The IUPAC name of 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene (CID 175420156) is 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene.
What is the SMILES notation for 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene?
The canonical SMILES for 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene is O=S(=O)(O)C1(O)c2ccccc2C=CC1O.c1ccc2ccccc2c1.
What is the InChIKey of 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene?
The InChIKey is YCIGIZMSBZHCDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5S.C10H8/c11-9-6-5-7-3-1-2-4-8(7)10(9,12)16(13,14)15;1-2-6-10-8-4-3-7-9(10)5-1/h1-6,9,11-12H,(H,13,14,15);1-8H.
What are the key properties of 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene?
1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene has a molecular weight of 370.43 g/mol, XLogP of 2.95, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxy-2H-naphthalene-1-sulfonic acid;naphthalene is sourced from PubChem (CID 175420156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).