About 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine
1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine (PubChem CID 175420736) has the molecular formula C9H17F3N2
and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine |
| PubChem CID | 175420736 |
| Molecular Formula | C9H17F3N2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine |
| SMILES | NCC1(NC(F)C(F)F)CCCCC1 |
| InChI | InChI=1S/C9H17F3N2/c10-7(11)8(12)14-9(6-13)4-2-1-3-5-9/h7-8,14H,1-6,13H2 |
| InChIKey | XTPBXSZAAQPKRK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine?
The IUPAC name of 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine (CID 175420736) is 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine.
What is the SMILES notation for 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine?
The canonical SMILES for 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine is NCC1(NC(F)C(F)F)CCCCC1.
What is the InChIKey of 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine?
The InChIKey is XTPBXSZAAQPKRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2/c10-7(11)8(12)14-9(6-13)4-2-1-3-5-9/h7-8,14H,1-6,13H2.
What are the key properties of 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine?
1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine has a molecular weight of 210.24 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-N-(1,2,2-trifluoroethyl)cyclohexan-1-amine is sourced from PubChem (CID 175420736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).