About hydrazine;platinum;quinazoline-2,4-diamine
hydrazine;platinum;quinazoline-2,4-diamine (PubChem CID 175421188) has the molecular formula C8H12N6Pt
and a molecular weight of 387.30 g/mol. Its IUPAC name is hydrazine;platinum;quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | hydrazine;platinum;quinazoline-2,4-diamine |
| PubChem CID | 175421188 |
| Molecular Formula | C8H12N6Pt |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | hydrazine;platinum;quinazoline-2,4-diamine |
| SMILES | NN.Nc1nc(N)c2ccccc2n1.[Pt] |
| InChI | InChI=1S/C8H8N4.H4N2.Pt/c9-7-5-3-1-2-4-6(5)11-8(10)12-7;1-2;/h1-4H,(H4,9,10,11,12);1-2H2; |
| InChIKey | JWIDCWYNQHGGMU-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;platinum;quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;platinum;quinazoline-2,4-diamine?
The IUPAC name of hydrazine;platinum;quinazoline-2,4-diamine (CID 175421188) is hydrazine;platinum;quinazoline-2,4-diamine.
What is the SMILES notation for hydrazine;platinum;quinazoline-2,4-diamine?
The canonical SMILES for hydrazine;platinum;quinazoline-2,4-diamine is NN.Nc1nc(N)c2ccccc2n1.[Pt].
What is the InChIKey of hydrazine;platinum;quinazoline-2,4-diamine?
The InChIKey is JWIDCWYNQHGGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4.H4N2.Pt/c9-7-5-3-1-2-4-6(5)11-8(10)12-7;1-2;/h1-4H,(H4,9,10,11,12);1-2H2;.
What are the key properties of hydrazine;platinum;quinazoline-2,4-diamine?
hydrazine;platinum;quinazoline-2,4-diamine has a molecular weight of 387.30 g/mol, XLogP of -0.39, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;platinum;quinazoline-2,4-diamine is sourced from PubChem (CID 175421188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).