C9H5F4NOS2 — CID 175421252
2-(1,2,2,2-tetrafluoroethyldisulfanyl)-1,3-benzoxazole (PubChem CID 175421252) has the molecular formula C9H5F4NOS2 and a molecular weight of 283.27 g/mol. Its IUPAC name is 2-(1,2,2,2-tetrafluoroethyldisulfanyl)-1,3-benzoxazole.
| Compound Name | 2-(1,2,2,2-tetrafluoroethyldisulfanyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 175421252 |
| Molecular Formula | C9H5F4NOS2 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 2-(1,2,2,2-tetrafluoroethyldisulfanyl)-1,3-benzoxazole |
| SMILES | FC(SSc1nc2ccccc2o1)C(F)(F)F |
| InChI | InChI=1S/C9H5F4NOS2/c10-7(9(11,12)13)16-17-8-14-5-3-1-2-4-6(5)15-8/h1-4,7H |
| InChIKey | FZWZQPURLRJAJM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|