About 2-(1,2,2-trifluoroethyl)pent-4-enal
2-(1,2,2-trifluoroethyl)pent-4-enal (PubChem CID 175421389) has the molecular formula C7H9F3O
and a molecular weight of 166.14 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethyl)pent-4-enal.
Molecular Properties
| Compound Name | 2-(1,2,2-trifluoroethyl)pent-4-enal |
| PubChem CID | 175421389 |
| Molecular Formula | C7H9F3O |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-(1,2,2-trifluoroethyl)pent-4-enal |
| SMILES | C=CCC(C=O)C(F)C(F)F |
| InChI | InChI=1S/C7H9F3O/c1-2-3-5(4-11)6(8)7(9)10/h2,4-7H,1,3H2 |
| InChIKey | FOJUAIHYRSJDAR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2,2-trifluoroethyl)pent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,2-trifluoroethyl)pent-4-enal?
The IUPAC name of 2-(1,2,2-trifluoroethyl)pent-4-enal (CID 175421389) is 2-(1,2,2-trifluoroethyl)pent-4-enal.
What is the SMILES notation for 2-(1,2,2-trifluoroethyl)pent-4-enal?
The canonical SMILES for 2-(1,2,2-trifluoroethyl)pent-4-enal is C=CCC(C=O)C(F)C(F)F.
What is the InChIKey of 2-(1,2,2-trifluoroethyl)pent-4-enal?
The InChIKey is FOJUAIHYRSJDAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3O/c1-2-3-5(4-11)6(8)7(9)10/h2,4-7H,1,3H2.
What are the key properties of 2-(1,2,2-trifluoroethyl)pent-4-enal?
2-(1,2,2-trifluoroethyl)pent-4-enal has a molecular weight of 166.14 g/mol, XLogP of 1.98, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,2-trifluoroethyl)pent-4-enal is sourced from PubChem (CID 175421389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).