About 4-chloro-4-fluorobutanal
4-chloro-4-fluorobutanal (PubChem CID 175421557) has the molecular formula C4H6ClFO
and a molecular weight of 124.54 g/mol. Its IUPAC name is 4-chloro-4-fluorobutanal.
Molecular Properties
| Compound Name | 4-chloro-4-fluorobutanal |
| PubChem CID | 175421557 |
| Molecular Formula | C4H6ClFO |
| Molecular Weight | 124.54 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | 4-chloro-4-fluorobutanal |
| SMILES | O=CCCC(F)Cl |
| InChI | InChI=1S/C4H6ClFO/c5-4(6)2-1-3-7/h3-4H,1-2H2 |
| InChIKey | MJCHUAOHXIWTJU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-4-fluorobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-4-fluorobutanal?
The IUPAC name of 4-chloro-4-fluorobutanal (CID 175421557) is 4-chloro-4-fluorobutanal.
What is the SMILES notation for 4-chloro-4-fluorobutanal?
The canonical SMILES for 4-chloro-4-fluorobutanal is O=CCCC(F)Cl.
What is the InChIKey of 4-chloro-4-fluorobutanal?
The InChIKey is MJCHUAOHXIWTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClFO/c5-4(6)2-1-3-7/h3-4H,1-2H2.
What are the key properties of 4-chloro-4-fluorobutanal?
4-chloro-4-fluorobutanal has a molecular weight of 124.54 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-4-fluorobutanal is sourced from PubChem (CID 175421557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).