C4H8F4N2 — CID 175422429
1,1,4,4-tetrafluorobutane-2,3-diamine (PubChem CID 175422429) has the molecular formula C4H8F4N2 and a molecular weight of 160.11 g/mol. Its IUPAC name is 1,1,4,4-tetrafluorobutane-2,3-diamine.
| Compound Name | 1,1,4,4-tetrafluorobutane-2,3-diamine |
|---|---|
| PubChem CID | 175422429 |
| Molecular Formula | C4H8F4N2 |
| Molecular Weight | 160.11 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1,1,4,4-tetrafluorobutane-2,3-diamine |
| SMILES | NC(C(F)F)C(N)C(F)F |
| InChI | InChI=1S/C4H8F4N2/c5-3(6)1(9)2(10)4(7)8/h1-4H,9-10H2 |
| InChIKey | HBQVITWNUNSCME-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.11 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |