C35H43NO4 — CID 175422484
2-[4-(diethylamino)-2-hydroxybenzoyl]benzaldehyde;toluene;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 175422484) has the molecular formula C35H43NO4 and a molecular weight of 541.73 g/mol. Its IUPAC name is 2-[4-(diethylamino)-2-hydroxybenzoyl]benzaldehyde;toluene;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 2-[4-(diethylamino)-2-hydroxybenzoyl]benzaldehyde;toluene;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 175422484 |
| Molecular Formula | C35H43NO4 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 2-[4-(diethylamino)-2-hydroxybenzoyl]benzaldehyde;toluene;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(CC1=O)C2(C)C.CCN(CC)c1ccc(C(=O)c2ccccc2C=O)c(O)c1.Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO3.C10H16O.C7H8/c1-3-19(4-2)14-9-10-16(17(21)11-14)18(22)15-8-6-5-7-13(15)12-20;1-9(2)7-4-5-10(9,3)8(11)6-7;1-7-5-3-2-4-6-7/h5-12,21H,3-4H2,1-2H3;7H,4-6H2,1-3H3;2-6H,1H3 |
| InChIKey | YMMBHXBDJUAYOC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|