About 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one
3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 175422623) has the molecular formula C21H15N5O
and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one |
| PubChem CID | 175422623 |
| Molecular Formula | C21H15N5O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | Cn1c2ccccc2c2cc(C=NN=C3C(=O)Nc4ccccc43)ncc21 |
| InChI | InChI=1S/C21H15N5O/c1-26-18-9-5-3-6-14(18)16-10-13(22-12-19(16)26)11-23-25-20-15-7-2-4-8-17(15)24-21(20)27/h2-12H,1H3,(H,24,25,27) |
| InChIKey | QUUWTKQKYQMERO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one?
The IUPAC name of 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one (CID 175422623) is 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one.
What is the SMILES notation for 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one?
The canonical SMILES for 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one is Cn1c2ccccc2c2cc(C=NN=C3C(=O)Nc4ccccc43)ncc21.
What is the InChIKey of 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one?
The InChIKey is QUUWTKQKYQMERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N5O/c1-26-18-9-5-3-6-14(18)16-10-13(22-12-19(16)26)11-23-25-20-15-7-2-4-8-17(15)24-21(20)27/h2-12H,1H3,(H,24,25,27).
What are the key properties of 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one?
3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one has a molecular weight of 353.39 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(9-methylpyrido[3,4-b]indol-3-yl)methylidenehydrazinylidene]-1H-indol-2-one is sourced from PubChem (CID 175422623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).