C9H13N2OZn- — CID 175423352
1-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrazole;zinc (PubChem CID 175423352) has the molecular formula C9H13N2OZn- and a molecular weight of 230.61 g/mol. Its IUPAC name is 1-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrazole;zinc.
| Compound Name | 1-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrazole;zinc |
|---|---|
| PubChem CID | 175423352 |
| Molecular Formula | C9H13N2OZn- |
| Molecular Weight | 230.61 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 1-methyl-4-(3,4,5,6-tetrahydro-2H-pyran-4-id-2-yl)pyrazole;zinc |
| SMILES | Cn1cc(C2C[CH-]CCO2)cn1.[Zn] |
| InChI | InChI=1S/C9H13N2O.Zn/c1-11-7-8(6-10-11)9-4-2-3-5-12-9;/h2,6-7,9H,3-5H2,1H3;/q-1; |
| InChIKey | VIADWGLEVJEKHW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.61 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|