C19H17FN2O3 — CID 175424034
4-(2,4-dimethoxyphenyl)-2-(3-fluoro-4-methoxyphenyl)pyrimidine (PubChem CID 175424034) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-2-(3-fluoro-4-methoxyphenyl)pyrimidine.
| Compound Name | 4-(2,4-dimethoxyphenyl)-2-(3-fluoro-4-methoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 175424034 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-2-(3-fluoro-4-methoxyphenyl)pyrimidine |
| SMILES | COc1ccc(-c2ccnc(-c3ccc(OC)c(F)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C19H17FN2O3/c1-23-13-5-6-14(18(11-13)25-3)16-8-9-21-19(22-16)12-4-7-17(24-2)15(20)10-12/h4-11H,1-3H3 |
| InChIKey | LHDJCRSQDKLJDO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |