About neodymium;1H-quinolin-2-one
neodymium;1H-quinolin-2-one (PubChem CID 175424246) has the molecular formula C9H7NNdO
and a molecular weight of 289.40 g/mol. Its IUPAC name is neodymium;1H-quinolin-2-one.
Molecular Properties
| Compound Name | neodymium;1H-quinolin-2-one |
| PubChem CID | 175424246 |
| Molecular Formula | C9H7NNdO |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | neodymium;1H-quinolin-2-one |
| SMILES | O=c1ccc2ccccc2[nH]1.[Nd] |
| InChI | InChI=1S/C9H7NO.Nd/c11-9-6-5-7-3-1-2-4-8(7)10-9;/h1-6H,(H,10,11); |
| InChIKey | FQJSQNMNOFIWCL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze neodymium;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neodymium;1H-quinolin-2-one?
The IUPAC name of neodymium;1H-quinolin-2-one (CID 175424246) is neodymium;1H-quinolin-2-one.
What is the SMILES notation for neodymium;1H-quinolin-2-one?
The canonical SMILES for neodymium;1H-quinolin-2-one is O=c1ccc2ccccc2[nH]1.[Nd].
What is the InChIKey of neodymium;1H-quinolin-2-one?
The InChIKey is FQJSQNMNOFIWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.Nd/c11-9-6-5-7-3-1-2-4-8(7)10-9;/h1-6H,(H,10,11);.
What are the key properties of neodymium;1H-quinolin-2-one?
neodymium;1H-quinolin-2-one has a molecular weight of 289.40 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for neodymium;1H-quinolin-2-one is sourced from PubChem (CID 175424246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).