C19H27BrN2O6 — CID 175424485
(2S)-3-[[(2S)-4-bromo-2-phenylmethoxybutanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 175424485) has the molecular formula C19H27BrN2O6 and a molecular weight of 459.34 g/mol. Its IUPAC name is (2S)-3-[[(2S)-4-bromo-2-phenylmethoxybutanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[[(2S)-4-bromo-2-phenylmethoxybutanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 175424485 |
| Molecular Formula | C19H27BrN2O6 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (2S)-3-[[(2S)-4-bromo-2-phenylmethoxybutanoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)[C@H](CCBr)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H27BrN2O6/c1-19(2,3)28-18(26)22-14(17(24)25)11-21-16(23)15(9-10-20)27-12-13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H,21,23)(H,22,26)(H,24,25)/t14-,15-/m0/s1 |
| InChIKey | AXZZDWINBFSNQM-GJZGRUSLSA-N |
| XLogP | 2.45 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|