About 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid
1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid (PubChem CID 175425257) has the molecular formula C17H34O4
and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid.
Molecular Properties
| Compound Name | 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid |
| PubChem CID | 175425257 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid |
| SMILES | CC(C)C(O)OC(C)C1(C)CCCCC1C.CCC(=O)O |
| InChI | InChI=1S/C14H28O2.C3H6O2/c1-10(2)13(15)16-12(4)14(5)9-7-6-8-11(14)3;1-2-3(4)5/h10-13,15H,6-9H2,1-5H3;2H2,1H3,(H,4,5) |
| InChIKey | HFBQRMLEXKLLEJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid?
The IUPAC name of 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid (CID 175425257) is 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid.
What is the SMILES notation for 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid?
The canonical SMILES for 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid is CC(C)C(O)OC(C)C1(C)CCCCC1C.CCC(=O)O.
What is the InChIKey of 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid?
The InChIKey is HFBQRMLEXKLLEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C3H6O2/c1-10(2)13(15)16-12(4)14(5)9-7-6-8-11(14)3;1-2-3(4)5/h10-13,15H,6-9H2,1-5H3;2H2,1H3,(H,4,5).
What are the key properties of 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid?
1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid has a molecular weight of 302.46 g/mol, XLogP of 4.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1,2-dimethylcyclohexyl)ethoxy]-2-methylpropan-1-ol;propanoic acid is sourced from PubChem (CID 175425257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).