About 1,1,2,2-tetramethoxypropan-1-ol;titanium
1,1,2,2-tetramethoxypropan-1-ol;titanium (PubChem CID 175425593) has the molecular formula C7H16O5Ti
and a molecular weight of 228.07 g/mol. Its IUPAC name is 1,1,2,2-tetramethoxypropan-1-ol;titanium.
Molecular Properties
| Compound Name | 1,1,2,2-tetramethoxypropan-1-ol;titanium |
| PubChem CID | 175425593 |
| Molecular Formula | C7H16O5Ti |
| Molecular Weight | 228.07 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1,1,2,2-tetramethoxypropan-1-ol;titanium |
| SMILES | COC(C)(OC)C(O)(OC)OC.[Ti] |
| InChI | InChI=1S/C7H16O5.Ti/c1-6(9-2,10-3)7(8,11-4)12-5;/h8H,1-5H3; |
| InChIKey | CPICRBMXYHRUFQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.07 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2,2-tetramethoxypropan-1-ol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,2-tetramethoxypropan-1-ol;titanium?
The IUPAC name of 1,1,2,2-tetramethoxypropan-1-ol;titanium (CID 175425593) is 1,1,2,2-tetramethoxypropan-1-ol;titanium.
What is the SMILES notation for 1,1,2,2-tetramethoxypropan-1-ol;titanium?
The canonical SMILES for 1,1,2,2-tetramethoxypropan-1-ol;titanium is COC(C)(OC)C(O)(OC)OC.[Ti].
What is the InChIKey of 1,1,2,2-tetramethoxypropan-1-ol;titanium?
The InChIKey is CPICRBMXYHRUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O5.Ti/c1-6(9-2,10-3)7(8,11-4)12-5;/h8H,1-5H3;.
What are the key properties of 1,1,2,2-tetramethoxypropan-1-ol;titanium?
1,1,2,2-tetramethoxypropan-1-ol;titanium has a molecular weight of 228.07 g/mol, XLogP of -0.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetramethoxypropan-1-ol;titanium is sourced from PubChem (CID 175425593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).