C17H13F3O — CID 175426427
6-methyl-3-phenyl-2-(1,2,2-trifluoroethyl)-1-benzofuran (PubChem CID 175426427) has the molecular formula C17H13F3O and a molecular weight of 290.28 g/mol. Its IUPAC name is 6-methyl-3-phenyl-2-(1,2,2-trifluoroethyl)-1-benzofuran.
| Compound Name | 6-methyl-3-phenyl-2-(1,2,2-trifluoroethyl)-1-benzofuran |
|---|---|
| PubChem CID | 175426427 |
| Molecular Formula | C17H13F3O |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 6-methyl-3-phenyl-2-(1,2,2-trifluoroethyl)-1-benzofuran |
| SMILES | Cc1ccc2c(-c3ccccc3)c(C(F)C(F)F)oc2c1 |
| InChI | InChI=1S/C17H13F3O/c1-10-7-8-12-13(9-10)21-16(15(18)17(19)20)14(12)11-5-3-2-4-6-11/h2-9,15,17H,1H3 |
| InChIKey | ZXSRXDMCDXPQHE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |