About 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine
10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine (PubChem CID 175426655) has the molecular formula C14H15NO2S
and a molecular weight of 261.35 g/mol. Its IUPAC name is 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine.
Molecular Properties
| Compound Name | 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine |
| PubChem CID | 175426655 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine |
| SMILES | COc1c(N)ccc2c1-c1csc(C)c1OCC2 |
| InChI | InChI=1S/C14H15NO2S/c1-8-13-10(7-18-8)12-9(5-6-17-13)3-4-11(15)14(12)16-2/h3-4,7H,5-6,15H2,1-2H3 |
| InChIKey | INVNMASNJNPNKU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine?
The IUPAC name of 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine (CID 175426655) is 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine.
What is the SMILES notation for 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine?
The canonical SMILES for 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine is COc1c(N)ccc2c1-c1csc(C)c1OCC2.
What is the InChIKey of 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine?
The InChIKey is INVNMASNJNPNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2S/c1-8-13-10(7-18-8)12-9(5-6-17-13)3-4-11(15)14(12)16-2/h3-4,7H,5-6,15H2,1-2H3.
What are the key properties of 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine?
10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine has a molecular weight of 261.35 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-3-methyl-5,6-dihydrothieno[3,4-a][3]benzoxepin-9-amine is sourced from PubChem (CID 175426655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).