C21H16 — CID 175426701
benzene;tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 175426701) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is benzene;tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | benzene;tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 175426701 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | benzene;tetracyclo[10.2.1.02,11.04,9]pentadeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | C1=C2CC(=C1)c1cc3ccccc3cc12.c1ccccc1 |
| InChI | InChI=1S/C15H10.C6H6/c1-2-4-11-9-15-13-6-5-12(7-13)14(15)8-10(11)3-1;1-2-4-6-5-3-1/h1-6,8-9H,7H2;1-6H |
| InChIKey | MDESDERWUQUOHQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |