About CID 175427190
CID 175427190 (PubChem CID 175427190) has the molecular formula H3N3O4S2-2
and a molecular weight of 173.18 g/mol.
Molecular Properties
| Compound Name | CID 175427190 |
| PubChem CID | 175427190 |
| Molecular Formula | H3N3O4S2-2 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 172.96 |
| IUPAC Name | — |
| SMILES | O=S([O-])NNNS(=O)[O-] |
| InChI | InChI=1S/H5N3O4S2/c4-8(5)2-1-3-9(6)7/h1-3H,(H,4,5)(H,6,7)/p-2 |
| InChIKey | LKEVUFACQGXIOE-UHFFFAOYSA-L |
| XLogP | -2.83 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 175427190 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175427190?
The IUPAC name of CID 175427190 (CID 175427190) is not available.
What is the SMILES notation for CID 175427190?
The canonical SMILES for CID 175427190 is O=S([O-])NNNS(=O)[O-].
What is the InChIKey of CID 175427190?
The InChIKey is LKEVUFACQGXIOE-UHFFFAOYSA-L. The full InChI is InChI=1S/H5N3O4S2/c4-8(5)2-1-3-9(6)7/h1-3H,(H,4,5)(H,6,7)/p-2.
What are the key properties of CID 175427190?
CID 175427190 has a molecular weight of 173.18 g/mol, XLogP of -2.83, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175427190 is sourced from PubChem (CID 175427190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).