C18H22FN3O4 — CID 175428525
[1-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]piperidin-4-yl] propanoate (PubChem CID 175428525) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is [1-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]piperidin-4-yl] propanoate.
| Compound Name | [1-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]piperidin-4-yl] propanoate |
|---|---|
| PubChem CID | 175428525 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [1-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]piperidin-4-yl] propanoate |
| SMILES | CCC(=O)OC1CCN(c2ccc(N3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C18H22FN3O4/c1-2-17(24)26-13-5-8-21(9-6-13)15-4-3-12(11-14(15)19)22-10-7-16(23)20-18(22)25/h3-4,11,13H,2,5-10H2,1H3,(H,20,23,25) |
| InChIKey | YKOZMVLQYRKJMG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|