C27H44O3 — CID 175429400
2-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-6-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 175429400) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is 2-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-6-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 175429400 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | 2-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C=C(C(O)/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C1=O |
| InChI | InChI=1S/C27H44O3/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22(5)16-26(29)25-18-24(28)17-23(6)27(25)30/h16-21,26,29H,7-15H2,1-6H3/b22-16+/t20-,21-,26?/m1/s1 |
| InChIKey | WAIRMQICOBWIOJ-NRQNOAITSA-N |
| XLogP | 6.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|