C28H46O3 — CID 175429416
5-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 175429416) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is 5-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 175429416 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | 5-[(E,7R,11R)-1-hydroxy-3,7,11,15-tetramethylhexadec-2-enyl]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C(O)/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)=CC1=O |
| InChI | InChI=1S/C28H46O3/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-22(5)17-27(30)25-18-26(29)23(6)24(7)28(25)31/h17-21,27,30H,8-16H2,1-7H3/b22-17+/t20-,21-,27?/m1/s1 |
| InChIKey | IIWHOQOQEPMAAO-YBHXWMKKSA-N |
| XLogP | 7.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|