About 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol
2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol (PubChem CID 175429838) has the molecular formula C16H8Cl4O3
and a molecular weight of 390.05 g/mol. Its IUPAC name is 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol.
Molecular Properties
| Compound Name | 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol |
| PubChem CID | 175429838 |
| Molecular Formula | C16H8Cl4O3 |
| Molecular Weight | 390.05 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)c2ccccc21.Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H4Cl2O2.C6H4Cl2O/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13;7-4-2-1-3-5(9)6(4)8/h1-4H;1-3,9H |
| InChIKey | ULRNNKLUVNIDPT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.05 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol?
The IUPAC name of 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol (CID 175429838) is 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol.
What is the SMILES notation for 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol?
The canonical SMILES for 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol is O=C1C(Cl)=C(Cl)C(=O)c2ccccc21.Oc1cccc(Cl)c1Cl.
What is the InChIKey of 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol?
The InChIKey is ULRNNKLUVNIDPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Cl2O2.C6H4Cl2O/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13;7-4-2-1-3-5(9)6(4)8/h1-4H;1-3,9H.
What are the key properties of 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol?
2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol has a molecular weight of 390.05 g/mol, XLogP of 5.45, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloronaphthalene-1,4-dione;2,3-dichlorophenol is sourced from PubChem (CID 175429838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).