About 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol
3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol (PubChem CID 175430177) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol.
Molecular Properties
| Compound Name | 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol |
| PubChem CID | 175430177 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol |
| SMILES | [H]/N=C/c1cccc(O)c1-c1ncn[nH]1 |
| InChI | InChI=1S/C9H8N4O/c10-4-6-2-1-3-7(14)8(6)9-11-5-12-13-9/h1-5,10,14H,(H,11,12,13)/b10-4+ |
| InChIKey | NVHZDZFODFRSPP-ONNFQVAWSA-N |
| XLogP | 1.17 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol?
The IUPAC name of 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol (CID 175430177) is 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol.
What is the SMILES notation for 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol?
The canonical SMILES for 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol is [H]/N=C/c1cccc(O)c1-c1ncn[nH]1.
What is the InChIKey of 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol?
The InChIKey is NVHZDZFODFRSPP-ONNFQVAWSA-N. The full InChI is InChI=1S/C9H8N4O/c10-4-6-2-1-3-7(14)8(6)9-11-5-12-13-9/h1-5,10,14H,(H,11,12,13)/b10-4+.
What are the key properties of 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol?
3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol has a molecular weight of 188.19 g/mol, XLogP of 1.17, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanimidoyl-2-(1H-1,2,4-triazol-5-yl)phenol is sourced from PubChem (CID 175430177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).