About 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol
2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol (PubChem CID 175431423) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol |
| PubChem CID | 175431423 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol |
| SMILES | CCC1OC(=O)CC(O)=C1O.CCCCCCO |
| InChI | InChI=1S/C7H10O4.C6H14O/c1-2-5-7(10)4(8)3-6(9)11-5;1-2-3-4-5-6-7/h5,8,10H,2-3H2,1H3;7H,2-6H2,1H3 |
| InChIKey | YDLFDKUEULEVCK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol?
The IUPAC name of 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol (CID 175431423) is 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol.
What is the SMILES notation for 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol?
The canonical SMILES for 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol is CCC1OC(=O)CC(O)=C1O.CCCCCCO.
What is the InChIKey of 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol?
The InChIKey is YDLFDKUEULEVCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4.C6H14O/c1-2-5-7(10)4(8)3-6(9)11-5;1-2-3-4-5-6-7/h5,8,10H,2-3H2,1H3;7H,2-6H2,1H3.
What are the key properties of 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol?
2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol has a molecular weight of 260.33 g/mol, XLogP of 2.60, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,4-dihydroxy-2,5-dihydropyran-6-one;hexan-1-ol is sourced from PubChem (CID 175431423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).