About 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol
4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol (PubChem CID 175432288) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 175432288 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol |
| SMILES | CCCC1(C(C)(C)C)C=C(C)C(O)=C(C)C1 |
| InChI | InChI=1S/C15H26O/c1-7-8-15(14(4,5)6)9-11(2)13(16)12(3)10-15/h9,16H,7-8,10H2,1-6H3 |
| InChIKey | UTZSJOUKZFNCPL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol (CID 175432288) is 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol is CCCC1(C(C)(C)C)C=C(C)C(O)=C(C)C1.
What is the InChIKey of 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol?
The InChIKey is UTZSJOUKZFNCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O/c1-7-8-15(14(4,5)6)9-11(2)13(16)12(3)10-15/h9,16H,7-8,10H2,1-6H3.
What are the key properties of 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol?
4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol has a molecular weight of 222.37 g/mol, XLogP of 5.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-dimethyl-4-propylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 175432288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).